C17H14Cl2F2N2O6 — CID 57244877
2-[2-[5-[2-chloro-4-[chloro(difluoro)methyl]phenoxy]-2-nitroanilino]ethoxy]acetic acid (PubChem CID 57244877) has the molecular formula C17H14Cl2F2N2O6 and a molecular weight of 451.21 g/mol. Its IUPAC name is 2-[2-[5-[2-chloro-4-[chloro(difluoro)methyl]phenoxy]-2-nitroanilino]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-[2-chloro-4-[chloro(difluoro)methyl]phenoxy]-2-nitroanilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 57244877 |
| Molecular Formula | C17H14Cl2F2N2O6 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-[2-[5-[2-chloro-4-[chloro(difluoro)methyl]phenoxy]-2-nitroanilino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1cc(Oc2ccc(C(F)(F)Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14Cl2F2N2O6/c18-12-7-10(17(19,20)21)1-4-15(12)29-11-2-3-14(23(26)27)13(8-11)22-5-6-28-9-16(24)25/h1-4,7-8,22H,5-6,9H2,(H,24,25) |
| InChIKey | CTLPQGDRVKAUOK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|