C18H17ClF3N3O5 — CID 5488605
butyl N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]carbamate (PubChem CID 5488605) has the molecular formula C18H17ClF3N3O5 and a molecular weight of 447.80 g/mol. Its IUPAC name is butyl N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]carbamate.
| Compound Name | butyl N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]carbamate |
|---|---|
| PubChem CID | 5488605 |
| Molecular Formula | C18H17ClF3N3O5 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | butyl N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]carbamate |
| SMILES | CCCCOC(=O)NNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17ClF3N3O5/c1-2-3-8-29-17(26)24-23-14-10-12(5-6-15(14)25(27)28)30-16-7-4-11(9-13(16)19)18(20,21)22/h4-7,9-10,23H,2-3,8H2,1H3,(H,24,26) |
| InChIKey | UYLIVRJKHLZVNE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|