C18H13ClF3NO7 — CID 19827374
(3-methoxy-3-oxopropyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 19827374) has the molecular formula C18H13ClF3NO7 and a molecular weight of 447.75 g/mol. Its IUPAC name is (3-methoxy-3-oxopropyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | (3-methoxy-3-oxopropyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 19827374 |
| Molecular Formula | C18H13ClF3NO7 |
| Molecular Weight | 447.75 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | (3-methoxy-3-oxopropyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | COC(=O)CCOC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13ClF3NO7/c1-28-16(24)6-7-29-17(25)12-9-11(3-4-14(12)23(26)27)30-15-5-2-10(8-13(15)19)18(20,21)22/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | LOXIXIVCSACZJB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|