C18H10ClF3N2O6 — CID 19097250
1,3-oxazol-5-ylmethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 19097250) has the molecular formula C18H10ClF3N2O6 and a molecular weight of 442.73 g/mol. Its IUPAC name is 1,3-oxazol-5-ylmethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 1,3-oxazol-5-ylmethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 19097250 |
| Molecular Formula | C18H10ClF3N2O6 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 1,3-oxazol-5-ylmethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | O=C(OCc1cnco1)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H10ClF3N2O6/c19-14-5-10(18(20,21)22)1-4-16(14)30-11-2-3-15(24(26)27)13(6-11)17(25)28-8-12-7-23-9-29-12/h1-7,9H,8H2 |
| InChIKey | HMHLGJLWJXXHFU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|