C23H17ClF3NO7S — CID 14050048
2-benzylsulfonylethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 14050048) has the molecular formula C23H17ClF3NO7S and a molecular weight of 543.90 g/mol. Its IUPAC name is 2-benzylsulfonylethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 2-benzylsulfonylethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 14050048 |
| Molecular Formula | C23H17ClF3NO7S |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | 2-benzylsulfonylethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | O=C(OCCS(=O)(=O)Cc1ccccc1)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17ClF3NO7S/c24-19-12-16(23(25,26)27)6-9-21(19)35-17-7-8-20(28(30)31)18(13-17)22(29)34-10-11-36(32,33)14-15-4-2-1-3-5-15/h1-9,12-13H,10-11,14H2 |
| InChIKey | HHJYPUJHAATKSU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|