C23H16Cl2F3NO5S — CID 14050047
2-benzylsulfanylethyl 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 14050047) has the molecular formula C23H16Cl2F3NO5S and a molecular weight of 546.35 g/mol. Its IUPAC name is 2-benzylsulfanylethyl 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 2-benzylsulfanylethyl 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 14050047 |
| Molecular Formula | C23H16Cl2F3NO5S |
| Molecular Weight | 546.35 g/mol |
| Exact Mass | 545.01 |
| IUPAC Name | 2-benzylsulfanylethyl 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | O=C(OCCSCc1ccccc1)c1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16Cl2F3NO5S/c24-18-10-15(23(26,27)28)11-19(25)21(18)34-16-6-7-20(29(31)32)17(12-16)22(30)33-8-9-35-13-14-4-2-1-3-5-14/h1-7,10-12H,8-9,13H2 |
| InChIKey | YMZHAIIUSNATQR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.35 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|