C17H10Cl2F3NO7 — CID 13092253
(2-methoxy-2-oxoethyl) 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 13092253) has the molecular formula C17H10Cl2F3NO7 and a molecular weight of 468.17 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 13092253 |
| Molecular Formula | C17H10Cl2F3NO7 |
| Molecular Weight | 468.17 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | COC(=O)COC(=O)c1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10Cl2F3NO7/c1-28-14(24)7-29-16(25)10-6-9(2-3-13(10)23(26)27)30-15-11(18)4-8(5-12(15)19)17(20,21)22/h2-6H,7H2,1H3 |
| InChIKey | KWLVZLMGVXMHQH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.17 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|