C16H11ClF3N3O7 — CID 88622919
methyl 2-[C-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-N-hydroxycarbonimidoyl]oxyacetate (PubChem CID 88622919) has the molecular formula C16H11ClF3N3O7 and a molecular weight of 449.73 g/mol. Its IUPAC name is methyl 2-[C-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-N-hydroxycarbonimidoyl]oxyacetate.
| Compound Name | methyl 2-[C-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-N-hydroxycarbonimidoyl]oxyacetate |
|---|---|
| PubChem CID | 88622919 |
| Molecular Formula | C16H11ClF3N3O7 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | methyl 2-[C-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-N-hydroxycarbonimidoyl]oxyacetate |
| SMILES | COC(=O)COC(=NO)c1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3N3O7/c1-28-13(24)7-29-14(22-25)10-5-9(2-3-12(10)23(26)27)30-15-11(17)4-8(6-21-15)16(18,19)20/h2-6,25H,7H2,1H3 |
| InChIKey | ASKTZMQAONHPNK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|