C15H10ClF3N4O4S — CID 70440955
methyl N-carbamoyl-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzenecarboximidothioate (PubChem CID 70440955) has the molecular formula C15H10ClF3N4O4S and a molecular weight of 434.78 g/mol. Its IUPAC name is methyl N-carbamoyl-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzenecarboximidothioate.
| Compound Name | methyl N-carbamoyl-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzenecarboximidothioate |
|---|---|
| PubChem CID | 70440955 |
| Molecular Formula | C15H10ClF3N4O4S |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | methyl N-carbamoyl-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzenecarboximidothioate |
| SMILES | CSC(=NC(N)=O)c1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10ClF3N4O4S/c1-28-13(22-14(20)24)9-5-8(2-3-11(9)23(25)26)27-12-10(16)4-7(6-21-12)15(17,18)19/h2-6H,1H3,(H2,20,24) |
| InChIKey | LKBQSMZHMKRKGE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|