C17H15F3N4O4S — CID 70441771
methyl N-(ethylcarbamoyl)-2-nitro-5-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenecarboximidothioate (PubChem CID 70441771) has the molecular formula C17H15F3N4O4S and a molecular weight of 428.39 g/mol. Its IUPAC name is methyl N-(ethylcarbamoyl)-2-nitro-5-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenecarboximidothioate.
| Compound Name | methyl N-(ethylcarbamoyl)-2-nitro-5-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenecarboximidothioate |
|---|---|
| PubChem CID | 70441771 |
| Molecular Formula | C17H15F3N4O4S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | methyl N-(ethylcarbamoyl)-2-nitro-5-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenecarboximidothioate |
| SMILES | CCNC(=O)N=C(SC)c1cc(Oc2ccc(C(F)(F)F)cn2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15F3N4O4S/c1-3-21-16(25)23-15(29-2)12-8-11(5-6-13(12)24(26)27)28-14-7-4-10(9-22-14)17(18,19)20/h4-9H,3H2,1-2H3,(H,21,25) |
| InChIKey | YKHYCIRFIINUEG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|