C20H16F3NO7 — CID 70451793
methyl 6-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]-3,6-dioxohexanoate (PubChem CID 70451793) has the molecular formula C20H16F3NO7 and a molecular weight of 439.34 g/mol. Its IUPAC name is methyl 6-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]-3,6-dioxohexanoate.
| Compound Name | methyl 6-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]-3,6-dioxohexanoate |
|---|---|
| PubChem CID | 70451793 |
| Molecular Formula | C20H16F3NO7 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | methyl 6-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]-3,6-dioxohexanoate |
| SMILES | COC(=O)CC(=O)CCC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16F3NO7/c1-30-19(27)10-13(25)4-9-18(26)16-11-15(7-8-17(16)24(28)29)31-14-5-2-12(3-6-14)20(21,22)23/h2-3,5-8,11H,4,9-10H2,1H3 |
| InChIKey | FWSUCNRGHJJRFS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|