C21H18ClF3O7S — CID 70401796
methyl 6-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfonylphenyl]-3,6-dioxohexanoate (PubChem CID 70401796) has the molecular formula C21H18ClF3O7S and a molecular weight of 506.88 g/mol. Its IUPAC name is methyl 6-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfonylphenyl]-3,6-dioxohexanoate.
| Compound Name | methyl 6-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfonylphenyl]-3,6-dioxohexanoate |
|---|---|
| PubChem CID | 70401796 |
| Molecular Formula | C21H18ClF3O7S |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | methyl 6-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfonylphenyl]-3,6-dioxohexanoate |
| SMILES | COC(=O)CC(=O)CCC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C21H18ClF3O7S/c1-31-20(28)10-13(26)4-6-17(27)15-11-14(5-8-19(15)33(2,29)30)32-18-7-3-12(9-16(18)22)21(23,24)25/h3,5,7-9,11H,4,6,10H2,1-2H3 |
| InChIKey | HFRQRNIWAUPASZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|