C16H11ClF3NO6 — CID 70481776
methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]acetate (PubChem CID 70481776) has the molecular formula C16H11ClF3NO6 and a molecular weight of 405.71 g/mol. Its IUPAC name is methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]acetate.
| Compound Name | methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 70481776 |
| Molecular Formula | C16H11ClF3NO6 |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3NO6/c1-25-15(22)8-26-14-7-10(3-4-12(14)21(23)24)27-13-5-2-9(6-11(13)17)16(18,19)20/h2-7H,8H2,1H3 |
| InChIKey | YWDJSHSHFLQDTQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|