C21H13ClF3NO7 — CID 19932402
2-[2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]-4-nitrophenoxy]phenoxy]acetic acid (PubChem CID 19932402) has the molecular formula C21H13ClF3NO7 and a molecular weight of 483.78 g/mol. Its IUPAC name is 2-[2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]-4-nitrophenoxy]phenoxy]acetic acid.
| Compound Name | 2-[2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]-4-nitrophenoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 19932402 |
| Molecular Formula | C21H13ClF3NO7 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 2-[2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]-4-nitrophenoxy]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1Oc1ccc([N+](=O)[O-])c(Oc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C21H13ClF3NO7/c22-14-9-12(21(23,24)25)5-8-16(14)33-19-10-13(6-7-15(19)26(29)30)32-18-4-2-1-3-17(18)31-11-20(27)28/h1-10H,11H2,(H,27,28) |
| InChIKey | KOYHUYOZVIQQII-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|