C17H14ClF3N2O5 — CID 21281522
N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methoxy]propan-2-imine (PubChem CID 21281522) has the molecular formula C17H14ClF3N2O5 and a molecular weight of 418.76 g/mol. Its IUPAC name is N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methoxy]propan-2-imine.
| Compound Name | N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methoxy]propan-2-imine |
|---|---|
| PubChem CID | 21281522 |
| Molecular Formula | C17H14ClF3N2O5 |
| Molecular Weight | 418.76 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methoxy]propan-2-imine |
| SMILES | CC(C)=NOCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClF3N2O5/c1-10(2)22-27-9-26-16-8-12(4-5-14(16)23(24)25)28-15-6-3-11(7-13(15)18)17(19,20)21/h3-8H,9H2,1-2H3 |
| InChIKey | QUZPFPCTTUJLPL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|