C19H16ClF3N2O5 — CID 154173821
methyl N-butanoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarboximidate (PubChem CID 154173821) has the molecular formula C19H16ClF3N2O5 and a molecular weight of 444.79 g/mol. Its IUPAC name is methyl N-butanoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarboximidate.
| Compound Name | methyl N-butanoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarboximidate |
|---|---|
| PubChem CID | 154173821 |
| Molecular Formula | C19H16ClF3N2O5 |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | methyl N-butanoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarboximidate |
| SMILES | CCCC(=O)/N=C(\OC)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16ClF3N2O5/c1-3-4-17(26)24-18(29-2)13-10-12(6-7-15(13)25(27)28)30-16-8-5-11(9-14(16)20)19(21,22)23/h5-10H,3-4H2,1-2H3/b24-18- |
| InChIKey | ZIRHDBNUOLFXKC-MOHJPFBDSA-N |
| XLogP | 5.78 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|