C19H15ClF3N3O6 — CID 173430012
4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-hydroxyimino-N,N-dimethyl-4-oxobutanamide (PubChem CID 173430012) has the molecular formula C19H15ClF3N3O6 and a molecular weight of 473.79 g/mol. Its IUPAC name is 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-hydroxyimino-N,N-dimethyl-4-oxobutanamide.
| Compound Name | 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-hydroxyimino-N,N-dimethyl-4-oxobutanamide |
|---|---|
| PubChem CID | 173430012 |
| Molecular Formula | C19H15ClF3N3O6 |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-hydroxyimino-N,N-dimethyl-4-oxobutanamide |
| SMILES | CN(C)C(=O)C(CC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])=NO |
| InChI | InChI=1S/C19H15ClF3N3O6/c1-25(2)18(28)14(24-29)9-16(27)12-8-11(4-5-15(12)26(30)31)32-17-6-3-10(7-13(17)20)19(21,22)23/h3-8,29H,9H2,1-2H3 |
| InChIKey | NCYNKGZICDQQND-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|