C18H14ClF3N2O5 — CID 15592972
methyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-propanoylbenzenecarboximidate (PubChem CID 15592972) has the molecular formula C18H14ClF3N2O5 and a molecular weight of 430.77 g/mol. Its IUPAC name is methyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-propanoylbenzenecarboximidate.
| Compound Name | methyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-propanoylbenzenecarboximidate |
|---|---|
| PubChem CID | 15592972 |
| Molecular Formula | C18H14ClF3N2O5 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | methyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-propanoylbenzenecarboximidate |
| SMILES | CCC(=O)/N=C(\OC)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14ClF3N2O5/c1-3-16(25)23-17(28-2)12-9-11(5-6-14(12)24(26)27)29-15-7-4-10(8-13(15)19)18(20,21)22/h4-9H,3H2,1-2H3/b23-17- |
| InChIKey | IZFQIYDOBRDTOW-QJOMJCCJSA-N |
| XLogP | 5.39 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|