C15H11ClF3N3O6S — CID 154043596
5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-hydroxy-N'-methylsulfonyl-2-nitrobenzenecarboximidamide (PubChem CID 154043596) has the molecular formula C15H11ClF3N3O6S and a molecular weight of 453.78 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-hydroxy-N'-methylsulfonyl-2-nitrobenzenecarboximidamide.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-hydroxy-N'-methylsulfonyl-2-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 154043596 |
| Molecular Formula | C15H11ClF3N3O6S |
| Molecular Weight | 453.78 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-hydroxy-N'-methylsulfonyl-2-nitrobenzenecarboximidamide |
| SMILES | CS(=O)(=O)N=C(NO)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11ClF3N3O6S/c1-29(26,27)21-14(20-23)10-7-9(3-4-12(10)22(24)25)28-13-5-2-8(6-11(13)16)15(17,18)19/h2-7,23H,1H3,(H,20,21) |
| InChIKey | VSHAECHGUXTBGF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|