C22H16ClF3N2O5S — CID 56616906
5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-2-nitrobenzamide (PubChem CID 56616906) has the molecular formula C22H16ClF3N2O5S and a molecular weight of 512.89 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-2-nitrobenzamide.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 56616906 |
| Molecular Formula | C22H16ClF3N2O5S |
| Molecular Weight | 512.89 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-2-nitrobenzamide |
| SMILES | C=S(=O)(NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C22H16ClF3N2O5S/c1-13-3-7-16(8-4-13)34(2,32)27-21(29)17-12-15(6-9-19(17)28(30)31)33-20-10-5-14(11-18(20)23)22(24,25)26/h3-12H,2H2,1H3,(H,27,29,32) |
| InChIKey | MNGWAAJXIMLXJU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|