C16H12ClF3N2O4S — CID 13259765
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-(2-sulfanylethyl)benzamide (PubChem CID 13259765) has the molecular formula C16H12ClF3N2O4S and a molecular weight of 420.80 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-(2-sulfanylethyl)benzamide.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-(2-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 13259765 |
| Molecular Formula | C16H12ClF3N2O4S |
| Molecular Weight | 420.80 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-(2-sulfanylethyl)benzamide |
| SMILES | O=C(NCCS)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClF3N2O4S/c17-12-7-9(16(18,19)20)1-4-14(12)26-10-2-3-13(22(24)25)11(8-10)15(23)21-5-6-27/h1-4,7-8,27H,5-6H2,(H,21,23) |
| InChIKey | KHHFPNKCFAEQIQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|