C16H11ClF3N2NaO7S — CID 88704196
sodium 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]ethanesulfonate (PubChem CID 88704196) has the molecular formula C16H11ClF3N2NaO7S and a molecular weight of 490.78 g/mol. Its IUPAC name is sodium 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]ethanesulfonate.
| Compound Name | sodium 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 88704196 |
| Molecular Formula | C16H11ClF3N2NaO7S |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | sodium 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]ethanesulfonate |
| SMILES | O=C(NCCS(=O)(=O)[O-])c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C16H12ClF3N2O7S.Na/c17-12-7-9(16(18,19)20)1-4-14(12)29-10-2-3-13(22(24)25)11(8-10)15(23)21-5-6-30(26,27)28;/h1-4,7-8H,5-6H2,(H,21,23)(H,26,27,28);/q;+1/p-1 |
| InChIKey | NMQDLVRKRNRHJD-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|