C18H15ClF3N3O6S — CID 154200630
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 154200630) has the molecular formula C18H15ClF3N3O6S and a molecular weight of 493.85 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 154200630 |
| Molecular Formula | C18H15ClF3N3O6S |
| Molecular Weight | 493.85 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)N1CCCC1)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15ClF3N3O6S/c19-14-9-11(18(20,21)22)3-6-16(14)31-12-4-5-15(25(27)28)13(10-12)17(26)23-32(29,30)24-7-1-2-8-24/h3-6,9-10H,1-2,7-8H2,(H,23,26) |
| InChIKey | STGPYAWIEVJQNR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|