C20H11Cl3F3N3O6S — CID 154187119
5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[(3,4-dichlorophenyl)sulfamoyl]-2-nitrobenzamide (PubChem CID 154187119) has the molecular formula C20H11Cl3F3N3O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[(3,4-dichlorophenyl)sulfamoyl]-2-nitrobenzamide.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[(3,4-dichlorophenyl)sulfamoyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 154187119 |
| Molecular Formula | C20H11Cl3F3N3O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 582.94 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[(3,4-dichlorophenyl)sulfamoyl]-2-nitrobenzamide |
| SMILES | O=C(NS(=O)(=O)Nc1ccc(Cl)c(Cl)c1)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H11Cl3F3N3O6S/c21-14-4-2-11(8-15(14)22)27-36(33,34)28-19(30)13-9-12(3-5-17(13)29(31)32)35-18-6-1-10(7-16(18)23)20(24,25)26/h1-9,27H,(H,28,30) |
| InChIKey | VOFZWQCUTIVLKU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|