C22H14ClF3N2O6 — CID 12912620
methyl 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]benzoate (PubChem CID 12912620) has the molecular formula C22H14ClF3N2O6 and a molecular weight of 494.81 g/mol. Its IUPAC name is methyl 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]benzoate.
| Compound Name | methyl 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 12912620 |
| Molecular Formula | C22H14ClF3N2O6 |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | methyl 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14ClF3N2O6/c1-33-21(30)14-4-2-3-5-17(14)27-20(29)15-11-13(7-8-18(15)28(31)32)34-19-9-6-12(10-16(19)23)22(24,25)26/h2-11H,1H3,(H,27,29) |
| InChIKey | HDINPOLBJJHZGB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|