C23H15ClF3NO7 — CID 19087542
(2-methoxy-2-oxo-1-phenylethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 19087542) has the molecular formula C23H15ClF3NO7 and a molecular weight of 509.82 g/mol. Its IUPAC name is (2-methoxy-2-oxo-1-phenylethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | (2-methoxy-2-oxo-1-phenylethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 19087542 |
| Molecular Formula | C23H15ClF3NO7 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | (2-methoxy-2-oxo-1-phenylethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | COC(=O)C(OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C23H15ClF3NO7/c1-33-22(30)20(13-5-3-2-4-6-13)35-21(29)16-12-15(8-9-18(16)28(31)32)34-19-10-7-14(11-17(19)24)23(25,26)27/h2-12,20H,1H3 |
| InChIKey | DCFNBAXVTTUHRN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|