C34H24Cl2F6N2O10 — CID 88750935
4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyhexan-2-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 88750935) has the molecular formula C34H24Cl2F6N2O10 and a molecular weight of 805.46 g/mol. Its IUPAC name is 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyhexan-2-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyhexan-2-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 88750935 |
| Molecular Formula | C34H24Cl2F6N2O10 |
| Molecular Weight | 805.46 g/mol |
| Exact Mass | 804.07 |
| IUPAC Name | 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyhexan-2-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | CCC(CC(C)OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H24Cl2F6N2O10/c1-3-20(54-32(46)24-16-22(7-9-28(24)44(49)50)53-30-11-5-19(14-26(30)36)34(40,41)42)12-17(2)51-31(45)23-15-21(6-8-27(23)43(47)48)52-29-10-4-18(13-25(29)35)33(37,38)39/h4-11,13-17,20H,3,12H2,1-2H3 |
| InChIKey | FXCSSKSAYXGIAC-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.46 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|