C18H12Cl2F3NO7 — CID 21279356
(1-acetyloxy-2-chloroethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 21279356) has the molecular formula C18H12Cl2F3NO7 and a molecular weight of 482.19 g/mol. Its IUPAC name is (1-acetyloxy-2-chloroethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | (1-acetyloxy-2-chloroethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 21279356 |
| Molecular Formula | C18H12Cl2F3NO7 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | (1-acetyloxy-2-chloroethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | CC(=O)OC(CCl)OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12Cl2F3NO7/c1-9(25)29-16(8-19)31-17(26)12-7-11(3-4-14(12)24(27)28)30-15-5-2-10(6-13(15)20)18(21,22)23/h2-7,16H,8H2,1H3 |
| InChIKey | UCXIRSREDDBIBI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|