C16H8ClF3NNaO7 — CID 70597280
sodium 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyacetate (PubChem CID 70597280) has the molecular formula C16H8ClF3NNaO7 and a molecular weight of 441.68 g/mol. Its IUPAC name is sodium 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyacetate.
| Compound Name | sodium 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyacetate |
|---|---|
| PubChem CID | 70597280 |
| Molecular Formula | C16H8ClF3NNaO7 |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | sodium 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl]oxyacetate |
| SMILES | O=C([O-])COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C16H9ClF3NO7.Na/c17-11-5-8(16(18,19)20)1-4-13(11)28-9-2-3-12(21(25)26)10(6-9)15(24)27-7-14(22)23;/h1-6H,7H2,(H,22,23);/q;+1/p-1 |
| InChIKey | PJOWOFZOKSHVDX-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 118.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|