C25H20ClF3N2O7S — CID 57205663
[1-[[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]-1-oxopropan-2-yl] 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 57205663) has the molecular formula C25H20ClF3N2O7S and a molecular weight of 584.96 g/mol. Its IUPAC name is [1-[[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]-1-oxopropan-2-yl] 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | [1-[[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]-1-oxopropan-2-yl] 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 57205663 |
| Molecular Formula | C25H20ClF3N2O7S |
| Molecular Weight | 584.96 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | [1-[[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]-1-oxopropan-2-yl] 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | C=S(=O)(NC(=O)C(C)OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C25H20ClF3N2O7S/c1-14-4-8-18(9-5-14)39(3,36)30-23(32)15(2)37-24(33)19-13-17(7-10-21(19)31(34)35)38-22-11-6-16(12-20(22)26)25(27,28)29/h4-13,15H,3H2,1-2H3,(H,30,32,36) |
| InChIKey | AVEDZIFCJRKABT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.96 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|