C23H20ClF3N4O8 — CID 118166522
(1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate;pyrazole-1-carboxamide (PubChem CID 118166522) has the molecular formula C23H20ClF3N4O8 and a molecular weight of 572.88 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate;pyrazole-1-carboxamide.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate;pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 118166522 |
| Molecular Formula | C23H20ClF3N4O8 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate;pyrazole-1-carboxamide |
| SMILES | CCOC(=O)C(C)OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].NC(=O)n1cccn1 |
| InChI | InChI=1S/C19H15ClF3NO7.C4H5N3O/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23;5-4(8)7-3-1-2-6-7/h4-10H,3H2,1-2H3;1-3H,(H2,5,8) |
| InChIKey | CFLYYISOVFILOH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 165.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|