C28H31ClF3N5O8S — CID 70136619
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea;(1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 70136619) has the molecular formula C28H31ClF3N5O8S and a molecular weight of 690.10 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea;(1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea;(1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 70136619 |
| Molecular Formula | C28H31ClF3N5O8S |
| Molecular Weight | 690.10 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea;(1-ethoxy-1-oxopropan-2-yl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | CCOC(=O)C(C)OC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].CNC(=O)N(C)c1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C19H15ClF3NO7.C9H16N4OS/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23;1-9(2,3)6-11-12-8(15-6)13(5)7(14)10-4/h4-10H,3H2,1-2H3;1-5H3,(H,10,14) |
| InChIKey | BJIHUWKUBQVMBB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.10 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|