C19H17ClF3NO5 — CID 57298368
ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]butanoate (PubChem CID 57298368) has the molecular formula C19H17ClF3NO5 and a molecular weight of 431.79 g/mol. Its IUPAC name is ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]butanoate.
| Compound Name | ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]butanoate |
|---|---|
| PubChem CID | 57298368 |
| Molecular Formula | C19H17ClF3NO5 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]butanoate |
| SMILES | CCOC(=O)C(CC)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17ClF3NO5/c1-3-13(18(25)28-4-2)14-10-12(6-7-16(14)24(26)27)29-17-8-5-11(9-15(17)20)19(21,22)23/h5-10,13H,3-4H2,1-2H3 |
| InChIKey | XZCCCYLPOPUAHF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|