C20H18ClF3N2O7 — CID 70404968
2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxy-2-oxoethyl)-2-nitroanilino]propanoic acid (PubChem CID 70404968) has the molecular formula C20H18ClF3N2O7 and a molecular weight of 490.82 g/mol. Its IUPAC name is 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxy-2-oxoethyl)-2-nitroanilino]propanoic acid.
| Compound Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxy-2-oxoethyl)-2-nitroanilino]propanoic acid |
|---|---|
| PubChem CID | 70404968 |
| Molecular Formula | C20H18ClF3N2O7 |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxy-2-oxoethyl)-2-nitroanilino]propanoic acid |
| SMILES | CCOC(=O)CN(c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(C)C(=O)O |
| InChI | InChI=1S/C20H18ClF3N2O7/c1-3-32-18(27)10-25(11(2)19(28)29)16-9-13(5-6-15(16)26(30)31)33-17-7-4-12(8-14(17)21)20(22,23)24/h4-9,11H,3,10H2,1-2H3,(H,28,29) |
| InChIKey | YEJONTRLSHGMCR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|