C21H20ClF3N2O8 — CID 70404604
1-(ethoxycarbonylamino)ethyl 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate (PubChem CID 70404604) has the molecular formula C21H20ClF3N2O8 and a molecular weight of 520.84 g/mol. Its IUPAC name is 1-(ethoxycarbonylamino)ethyl 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate.
| Compound Name | 1-(ethoxycarbonylamino)ethyl 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 70404604 |
| Molecular Formula | C21H20ClF3N2O8 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 1-(ethoxycarbonylamino)ethyl 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)NC(C)OC(=O)CCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20ClF3N2O8/c1-3-32-20(29)26-12(2)34-19(28)8-9-33-18-11-14(5-6-16(18)27(30)31)35-17-7-4-13(10-15(17)22)21(23,24)25/h4-7,10-12H,3,8-9H2,1-2H3,(H,26,29) |
| InChIKey | OZCYNELMASEARK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|