C19H20ClF3N2O6S — CID 22841528
(2S)-2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]amino]propanoate;trimethylsulfanium (PubChem CID 22841528) has the molecular formula C19H20ClF3N2O6S and a molecular weight of 496.89 g/mol. Its IUPAC name is (2S)-2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]amino]propanoate;trimethylsulfanium.
| Compound Name | (2S)-2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]amino]propanoate;trimethylsulfanium |
|---|---|
| PubChem CID | 22841528 |
| Molecular Formula | C19H20ClF3N2O6S |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | (2S)-2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]amino]propanoate;trimethylsulfanium |
| SMILES | C[C@H](NOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)[O-].C[S+](C)C |
| InChI | InChI=1S/C16H12ClF3N2O6.C3H9S/c1-8(15(23)24)21-28-14-7-10(3-4-12(14)22(25)26)27-13-5-2-9(6-11(13)17)16(18,19)20;1-4(2)3/h2-8,21H,1H3,(H,23,24);1-3H3/q;+1/p-1/t8-;/m0./s1 |
| InChIKey | ZTQISSIPXWUHGF-QRPNPIFTSA-M |
| XLogP | 3.58 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|