C18H18ClF3N4O4 — CID 54009631
2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-N',N'-dimethylpropanehydrazide (PubChem CID 54009631) has the molecular formula C18H18ClF3N4O4 and a molecular weight of 446.81 g/mol. Its IUPAC name is 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-N',N'-dimethylpropanehydrazide.
| Compound Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 54009631 |
| Molecular Formula | C18H18ClF3N4O4 |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-N',N'-dimethylpropanehydrazide |
| SMILES | CC(Nc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)NN(C)C |
| InChI | InChI=1S/C18H18ClF3N4O4/c1-10(17(27)24-25(2)3)23-14-9-12(5-6-15(14)26(28)29)30-16-7-4-11(8-13(16)19)18(20,21)22/h4-10,23H,1-3H3,(H,24,27) |
| InChIKey | KRJRCMQMMQNBJH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|