C17H16ClF3N2O4 — CID 139807741
5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-methoxypropyl)-2-nitroaniline (PubChem CID 139807741) has the molecular formula C17H16ClF3N2O4 and a molecular weight of 404.77 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-methoxypropyl)-2-nitroaniline.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-methoxypropyl)-2-nitroaniline |
|---|---|
| PubChem CID | 139807741 |
| Molecular Formula | C17H16ClF3N2O4 |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-methoxypropyl)-2-nitroaniline |
| SMILES | COC(C)CNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16ClF3N2O4/c1-10(26-2)9-22-14-8-12(4-5-15(14)23(24)25)27-16-6-3-11(7-13(16)18)17(19,20)21/h3-8,10,22H,9H2,1-2H3 |
| InChIKey | LARGCFGONWTNTP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|