C18H18ClF3N2O4 — CID 139807744
5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxypropyl)-2-nitroaniline (PubChem CID 139807744) has the molecular formula C18H18ClF3N2O4 and a molecular weight of 418.80 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxypropyl)-2-nitroaniline.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxypropyl)-2-nitroaniline |
|---|---|
| PubChem CID | 139807744 |
| Molecular Formula | C18H18ClF3N2O4 |
| Molecular Weight | 418.80 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(2-ethoxypropyl)-2-nitroaniline |
| SMILES | CCOC(C)CNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18ClF3N2O4/c1-3-27-11(2)10-23-15-9-13(5-6-16(15)24(25)26)28-17-7-4-12(8-14(17)19)18(20,21)22/h4-9,11,23H,3,10H2,1-2H3 |
| InChIKey | IULCBUORIWLJDJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|