C21H24ClF3N2O6 — CID 70443253
5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]-2-nitroaniline (PubChem CID 70443253) has the molecular formula C21H24ClF3N2O6 and a molecular weight of 492.88 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]-2-nitroaniline.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 70443253 |
| Molecular Formula | C21H24ClF3N2O6 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-[1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]-2-nitroaniline |
| SMILES | COCCOCCOCC(C)Nc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24ClF3N2O6/c1-14(13-32-10-9-31-8-7-30-2)26-18-12-16(4-5-19(18)27(28)29)33-20-6-3-15(11-17(20)22)21(23,24)25/h3-6,11-12,14,26H,7-10,13H2,1-2H3 |
| InChIKey | HGGLMCRSYKPCRN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|