C19H18ClF3N2O7 — CID 70492754
2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-3-methoxypropoxy]acetic acid (PubChem CID 70492754) has the molecular formula C19H18ClF3N2O7 and a molecular weight of 478.81 g/mol. Its IUPAC name is 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-3-methoxypropoxy]acetic acid.
| Compound Name | 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-3-methoxypropoxy]acetic acid |
|---|---|
| PubChem CID | 70492754 |
| Molecular Formula | C19H18ClF3N2O7 |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-3-methoxypropoxy]acetic acid |
| SMILES | COCC(COCC(=O)O)Nc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18ClF3N2O7/c1-30-8-12(9-31-10-18(26)27)24-15-7-13(3-4-16(15)25(28)29)32-17-5-2-11(6-14(17)20)19(21,22)23/h2-7,12,24H,8-10H2,1H3,(H,26,27) |
| InChIKey | BKZBBYMQUJZMTE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|