C17H16ClF3N2O3 — CID 70464956
N-tert-butyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroaniline (PubChem CID 70464956) has the molecular formula C17H16ClF3N2O3 and a molecular weight of 388.77 g/mol. Its IUPAC name is N-tert-butyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroaniline.
| Compound Name | N-tert-butyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroaniline |
|---|---|
| PubChem CID | 70464956 |
| Molecular Formula | C17H16ClF3N2O3 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N-tert-butyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroaniline |
| SMILES | CC(C)(C)Nc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16ClF3N2O3/c1-16(2,3)22-13-9-11(5-6-14(13)23(24)25)26-15-7-4-10(8-12(15)18)17(19,20)21/h4-9,22H,1-3H3 |
| InChIKey | SYDKOOOICWVKSL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|