C17H19F3N2O6P+ — CID 70464751
N-tert-butyl-2-nitro-5-[4-(trifluoromethyl)phenoxy]aniline;dihydroxy(oxo)phosphanium (PubChem CID 70464751) has the molecular formula C17H19F3N2O6P+ and a molecular weight of 435.32 g/mol. Its IUPAC name is N-tert-butyl-2-nitro-5-[4-(trifluoromethyl)phenoxy]aniline;dihydroxy(oxo)phosphanium.
| Compound Name | N-tert-butyl-2-nitro-5-[4-(trifluoromethyl)phenoxy]aniline;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 70464751 |
| Molecular Formula | C17H19F3N2O6P+ |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-tert-butyl-2-nitro-5-[4-(trifluoromethyl)phenoxy]aniline;dihydroxy(oxo)phosphanium |
| SMILES | CC(C)(C)Nc1cc(Oc2ccc(C(F)(F)F)cc2)ccc1[N+](=O)[O-].O=[P+](O)O |
| InChI | InChI=1S/C17H17F3N2O3.HO3P/c1-16(2,3)21-14-10-13(8-9-15(14)22(23)24)25-12-6-4-11(5-7-12)17(18,19)20;1-4(2)3/h4-10,21H,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | CRQDHKLDUVDOJR-UHFFFAOYSA-O |
| XLogP | 5.24 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|