C16H19ClN2O6P+ — CID 70464981
N-tert-butyl-5-(4-chlorophenoxy)-2-nitroaniline;dihydroxy(oxo)phosphanium (PubChem CID 70464981) has the molecular formula C16H19ClN2O6P+ and a molecular weight of 401.76 g/mol. Its IUPAC name is N-tert-butyl-5-(4-chlorophenoxy)-2-nitroaniline;dihydroxy(oxo)phosphanium.
| Compound Name | N-tert-butyl-5-(4-chlorophenoxy)-2-nitroaniline;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 70464981 |
| Molecular Formula | C16H19ClN2O6P+ |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-tert-butyl-5-(4-chlorophenoxy)-2-nitroaniline;dihydroxy(oxo)phosphanium |
| SMILES | CC(C)(C)Nc1cc(Oc2ccc(Cl)cc2)ccc1[N+](=O)[O-].O=[P+](O)O |
| InChI | InChI=1S/C16H17ClN2O3.HO3P/c1-16(2,3)18-14-10-13(8-9-15(14)19(20)21)22-12-6-4-11(17)5-7-12;1-4(2)3/h4-10,18H,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | YDOZOIPOYALYDF-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|