C16H17Cl3N2O6P+ — CID 70465488
dimethoxy(oxo)phosphanium;N-ethyl-2-nitro-5-(2,4,6-trichlorophenoxy)aniline (PubChem CID 70465488) has the molecular formula C16H17Cl3N2O6P+ and a molecular weight of 470.65 g/mol. Its IUPAC name is dimethoxy(oxo)phosphanium;N-ethyl-2-nitro-5-(2,4,6-trichlorophenoxy)aniline.
| Compound Name | dimethoxy(oxo)phosphanium;N-ethyl-2-nitro-5-(2,4,6-trichlorophenoxy)aniline |
|---|---|
| PubChem CID | 70465488 |
| Molecular Formula | C16H17Cl3N2O6P+ |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | dimethoxy(oxo)phosphanium;N-ethyl-2-nitro-5-(2,4,6-trichlorophenoxy)aniline |
| SMILES | CCNc1cc(Oc2c(Cl)cc(Cl)cc2Cl)ccc1[N+](=O)[O-].CO[P+](=O)OC |
| InChI | InChI=1S/C14H11Cl3N2O3.C2H6O3P/c1-2-18-12-7-9(3-4-13(12)19(20)21)22-14-10(16)5-8(15)6-11(14)17;1-4-6(3)5-2/h3-7,18H,2H2,1H3;1-2H3/q;+1 |
| InChIKey | FVMUJZLOPPNNRS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|