C18H19ClF4N2O7P+ — CID 88728380
5-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]-N-ethyl-2-nitroaniline;dimethoxy(oxo)phosphanium (PubChem CID 88728380) has the molecular formula C18H19ClF4N2O7P+ and a molecular weight of 517.78 g/mol. Its IUPAC name is 5-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]-N-ethyl-2-nitroaniline;dimethoxy(oxo)phosphanium.
| Compound Name | 5-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]-N-ethyl-2-nitroaniline;dimethoxy(oxo)phosphanium |
|---|---|
| PubChem CID | 88728380 |
| Molecular Formula | C18H19ClF4N2O7P+ |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 5-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]-N-ethyl-2-nitroaniline;dimethoxy(oxo)phosphanium |
| SMILES | CCNc1cc(Oc2ccc(OC(F)(F)C(F)F)cc2Cl)ccc1[N+](=O)[O-].CO[P+](=O)OC |
| InChI | InChI=1S/C16H13ClF4N2O4.C2H6O3P/c1-2-22-12-8-9(3-5-13(12)23(24)25)26-14-6-4-10(7-11(14)17)27-16(20,21)15(18)19;1-4-6(3)5-2/h3-8,15,22H,2H2,1H3;1-2H3/q;+1 |
| InChIKey | IHLNRXBDQKJJHD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|