C19H23F3N3O7P — CID 88729030
butane;N-ethyl-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]aniline;phosphenous acid (PubChem CID 88729030) has the molecular formula C19H23F3N3O7P and a molecular weight of 493.38 g/mol. Its IUPAC name is butane;N-ethyl-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]aniline;phosphenous acid.
| Compound Name | butane;N-ethyl-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]aniline;phosphenous acid |
|---|---|
| PubChem CID | 88729030 |
| Molecular Formula | C19H23F3N3O7P |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | butane;N-ethyl-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]aniline;phosphenous acid |
| SMILES | CCCC.CCNc1cc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])ccc1[N+](=O)[O-].O=PO |
| InChI | InChI=1S/C15H12F3N3O5.C4H10.HO2P/c1-2-19-11-8-10(4-5-12(11)20(22)23)26-14-6-3-9(15(16,17)18)7-13(14)21(24)25;1-3-4-2;1-3-2/h3-8,19H,2H2,1H3;3-4H2,1-2H3;(H,1,2) |
| InChIKey | IDTMTKYAUNYQQA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|