C15H10Cl3F3NO4P — CID 54115191
1,3-dichloro-2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzene (PubChem CID 54115191) has the molecular formula C15H10Cl3F3NO4P and a molecular weight of 462.58 g/mol. Its IUPAC name is 1,3-dichloro-2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzene.
| Compound Name | 1,3-dichloro-2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54115191 |
| Molecular Formula | C15H10Cl3F3NO4P |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | 1,3-dichloro-2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzene |
| SMILES | CCP(=O)(Cl)c1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Cl3F3NO4P/c1-2-27(18,25)13-7-9(3-4-12(13)22(23)24)26-14-10(16)5-8(6-11(14)17)15(19,20)21/h3-7H,2H2,1H3 |
| InChIKey | NJVQURNWMVHWLY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|