C18H17Cl2F3NO6P — CID 13239689
1,3-dichloro-2-[3-(diethoxyphosphorylmethyl)-4-nitrophenoxy]-5-(trifluoromethyl)benzene (PubChem CID 13239689) has the molecular formula C18H17Cl2F3NO6P and a molecular weight of 502.21 g/mol. Its IUPAC name is 1,3-dichloro-2-[3-(diethoxyphosphorylmethyl)-4-nitrophenoxy]-5-(trifluoromethyl)benzene.
| Compound Name | 1,3-dichloro-2-[3-(diethoxyphosphorylmethyl)-4-nitrophenoxy]-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 13239689 |
| Molecular Formula | C18H17Cl2F3NO6P |
| Molecular Weight | 502.21 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 1,3-dichloro-2-[3-(diethoxyphosphorylmethyl)-4-nitrophenoxy]-5-(trifluoromethyl)benzene |
| SMILES | CCOP(=O)(Cc1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C18H17Cl2F3NO6P/c1-3-28-31(27,29-4-2)10-11-7-13(5-6-16(11)24(25)26)30-17-14(19)8-12(9-15(17)20)18(21,22)23/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | HZCSJCFAQVTHGY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.21 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|