C16H12ClF4N3O4 — CID 67920274
5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide (PubChem CID 67920274) has the molecular formula C16H12ClF4N3O4 and a molecular weight of 421.73 g/mol. Its IUPAC name is 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide.
| Compound Name | 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 67920274 |
| Molecular Formula | C16H12ClF4N3O4 |
| Molecular Weight | 421.73 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide |
| SMILES | CN(C)NC(=O)c1cc(Oc2c(F)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClF4N3O4/c1-23(2)22-15(25)10-7-9(3-4-13(10)24(26)27)28-14-11(17)5-8(6-12(14)18)16(19,20)21/h3-7H,1-2H3,(H,22,25) |
| InChIKey | AYDLRFNZLDMZBN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|